C20H22NO4- — CID 6957833
3-[[2-(4-tert-butylphenoxy)acetyl]amino]-2-methylbenzoate (PubChem CID 6957833) has the molecular formula C20H22NO4- and a molecular weight of 340.40 g/mol. Its IUPAC name is 3-[[2-(4-tert-butylphenoxy)acetyl]amino]-2-methylbenzoate.
| Compound Name | 3-[[2-(4-tert-butylphenoxy)acetyl]amino]-2-methylbenzoate |
|---|---|
| PubChem CID | 6957833 |
| Molecular Formula | C20H22NO4- |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 3-[[2-(4-tert-butylphenoxy)acetyl]amino]-2-methylbenzoate |
| SMILES | Cc1c(NC(=O)COc2ccc(C(C)(C)C)cc2)cccc1C(=O)[O-] |
| InChI | InChI=1S/C20H23NO4/c1-13-16(19(23)24)6-5-7-17(13)21-18(22)12-25-15-10-8-14(9-11-15)20(2,3)4/h5-11H,12H2,1-4H3,(H,21,22)(H,23,24)/p-1 |
| InChIKey | PGVDWUCFYFCTDZ-UHFFFAOYSA-M |
| XLogP | 2.67 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |