C18H19NO4 — CID 40910613
3-[[2-(3,4-dimethylphenoxy)acetyl]amino]-2-methylbenzoic acid (PubChem CID 40910613) has the molecular formula C18H19NO4 and a molecular weight of 313.35 g/mol. Its IUPAC name is 3-[[2-(3,4-dimethylphenoxy)acetyl]amino]-2-methylbenzoic acid.
| Compound Name | 3-[[2-(3,4-dimethylphenoxy)acetyl]amino]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 40910613 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 3-[[2-(3,4-dimethylphenoxy)acetyl]amino]-2-methylbenzoic acid |
| SMILES | Cc1ccc(OCC(=O)Nc2cccc(C(=O)O)c2C)cc1C |
| InChI | InChI=1S/C18H19NO4/c1-11-7-8-14(9-12(11)2)23-10-17(20)19-16-6-4-5-15(13(16)3)18(21)22/h4-9H,10H2,1-3H3,(H,19,20)(H,21,22) |
| InChIKey | TUJZDAPWJVJSQE-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |