C17H16NO5- — CID 54716594
4-carboxy-3-[[2-(3,4-dimethylphenoxy)acetyl]amino]phenolate (PubChem CID 54716594) has the molecular formula C17H16NO5- and a molecular weight of 314.32 g/mol. Its IUPAC name is 4-carboxy-3-[[2-(3,4-dimethylphenoxy)acetyl]amino]phenolate.
| Compound Name | 4-carboxy-3-[[2-(3,4-dimethylphenoxy)acetyl]amino]phenolate |
|---|---|
| PubChem CID | 54716594 |
| Molecular Formula | C17H16NO5- |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 4-carboxy-3-[[2-(3,4-dimethylphenoxy)acetyl]amino]phenolate |
| SMILES | Cc1ccc(OCC(=O)Nc2cc([O-])ccc2C(=O)O)cc1C |
| InChI | InChI=1S/C17H17NO5/c1-10-3-5-13(7-11(10)2)23-9-16(20)18-15-8-12(19)4-6-14(15)17(21)22/h3-8,19H,9H2,1-2H3,(H,18,20)(H,21,22)/p-1 |
| InChIKey | LFHCINRDLICIQQ-UHFFFAOYSA-M |
| XLogP | 2.09 |
| TPSA | 98.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |