C17H15ClNO4- — CID 7372746
4-chloro-2-[[2-(3,4-dimethylphenoxy)acetyl]amino]benzoate (PubChem CID 7372746) has the molecular formula C17H15ClNO4- and a molecular weight of 332.76 g/mol. Its IUPAC name is 4-chloro-2-[[2-(3,4-dimethylphenoxy)acetyl]amino]benzoate.
| Compound Name | 4-chloro-2-[[2-(3,4-dimethylphenoxy)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 7372746 |
| Molecular Formula | C17H15ClNO4- |
| Molecular Weight | 332.76 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | 4-chloro-2-[[2-(3,4-dimethylphenoxy)acetyl]amino]benzoate |
| SMILES | Cc1ccc(OCC(=O)Nc2cc(Cl)ccc2C(=O)[O-])cc1C |
| InChI | InChI=1S/C17H16ClNO4/c1-10-3-5-13(7-11(10)2)23-9-16(20)19-15-8-12(18)4-6-14(15)17(21)22/h3-8H,9H2,1-2H3,(H,19,20)(H,21,22)/p-1 |
| InChIKey | DABQRLIUIXPPIO-UHFFFAOYSA-M |
| XLogP | 2.34 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.76 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |