C19H20N2O4S — CID 4507708
3-[[2-(3,4-dimethylphenoxy)acetyl]carbamothioylamino]-2-methylbenzoic acid (PubChem CID 4507708) has the molecular formula C19H20N2O4S and a molecular weight of 372.45 g/mol. Its IUPAC name is 3-[[2-(3,4-dimethylphenoxy)acetyl]carbamothioylamino]-2-methylbenzoic acid.
| Compound Name | 3-[[2-(3,4-dimethylphenoxy)acetyl]carbamothioylamino]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 4507708 |
| Molecular Formula | C19H20N2O4S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 3-[[2-(3,4-dimethylphenoxy)acetyl]carbamothioylamino]-2-methylbenzoic acid |
| SMILES | Cc1ccc(OCC(=O)NC(=S)Nc2cccc(C(=O)O)c2C)cc1C |
| InChI | InChI=1S/C19H20N2O4S/c1-11-7-8-14(9-12(11)2)25-10-17(22)21-19(26)20-16-6-4-5-15(13(16)3)18(23)24/h4-9H,10H2,1-3H3,(H,23,24)(H2,20,21,22,26) |
| InChIKey | SPZHFXCFOWRNMK-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|