C25H30F3N3O3 — CID 60613622
(E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]-N-[1-[2-(4-ethylpiperazin-1-yl)-5-fluorophenyl]ethyl]prop-2-enamide (PubChem CID 60613622) has the molecular formula C25H30F3N3O3 and a molecular weight of 477.53 g/mol. Its IUPAC name is (E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]-N-[1-[2-(4-ethylpiperazin-1-yl)-5-fluorophenyl]ethyl]prop-2-enamide.
| Compound Name | (E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]-N-[1-[2-(4-ethylpiperazin-1-yl)-5-fluorophenyl]ethyl]prop-2-enamide |
|---|---|
| PubChem CID | 60613622 |
| Molecular Formula | C25H30F3N3O3 |
| Molecular Weight | 477.53 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | (E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]-N-[1-[2-(4-ethylpiperazin-1-yl)-5-fluorophenyl]ethyl]prop-2-enamide |
| SMILES | CCN1CCN(c2ccc(F)cc2C(C)NC(=O)/C=C/c2cccc(OC)c2OC(F)F)CC1 |
| InChI | InChI=1S/C25H30F3N3O3/c1-4-30-12-14-31(15-13-30)21-10-9-19(26)16-20(21)17(2)29-23(32)11-8-18-6-5-7-22(33-3)24(18)34-25(27)28/h5-11,16-17,25H,4,12-15H2,1-3H3,(H,29,32)/b11-8+ |
| InChIKey | ATMRZIUQZPVOGP-DHZHZOJOSA-N |
| XLogP | 4.47 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.53 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|