C17H27FN4O — CID 119902822
(2R)-2-amino-N-[1-[2-(4-ethylpiperazin-1-yl)-5-fluorophenyl]ethyl]propanamide (PubChem CID 119902822) has the molecular formula C17H27FN4O and a molecular weight of 322.43 g/mol. Its IUPAC name is (2R)-2-amino-N-[1-[2-(4-ethylpiperazin-1-yl)-5-fluorophenyl]ethyl]propanamide.
| Compound Name | (2R)-2-amino-N-[1-[2-(4-ethylpiperazin-1-yl)-5-fluorophenyl]ethyl]propanamide |
|---|---|
| PubChem CID | 119902822 |
| Molecular Formula | C17H27FN4O |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.22 |
| IUPAC Name | (2R)-2-amino-N-[1-[2-(4-ethylpiperazin-1-yl)-5-fluorophenyl]ethyl]propanamide |
| SMILES | CCN1CCN(c2ccc(F)cc2C(C)NC(=O)[C@@H](C)N)CC1 |
| InChI | InChI=1S/C17H27FN4O/c1-4-21-7-9-22(10-8-21)16-6-5-14(18)11-15(16)13(3)20-17(23)12(2)19/h5-6,11-13H,4,7-10,19H2,1-3H3,(H,20,23)/t12-,13?/m1/s1 |
| InChIKey | WKAFXVRGOLLKCG-PZORYLMUSA-N |
| XLogP | 1.49 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |