C17H27FN4O2 — CID 110922301
1-[1-[5-fluoro-2-(4-methylpiperazin-1-yl)phenyl]ethyl]-3-(1-hydroxypropan-2-yl)urea (PubChem CID 110922301) has the molecular formula C17H27FN4O2 and a molecular weight of 338.43 g/mol. Its IUPAC name is 1-[1-[5-fluoro-2-(4-methylpiperazin-1-yl)phenyl]ethyl]-3-(1-hydroxypropan-2-yl)urea.
| Compound Name | 1-[1-[5-fluoro-2-(4-methylpiperazin-1-yl)phenyl]ethyl]-3-(1-hydroxypropan-2-yl)urea |
|---|---|
| PubChem CID | 110922301 |
| Molecular Formula | C17H27FN4O2 |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 1-[1-[5-fluoro-2-(4-methylpiperazin-1-yl)phenyl]ethyl]-3-(1-hydroxypropan-2-yl)urea |
| SMILES | CC(CO)NC(=O)NC(C)c1cc(F)ccc1N1CCN(C)CC1 |
| InChI | InChI=1S/C17H27FN4O2/c1-12(11-23)19-17(24)20-13(2)15-10-14(18)4-5-16(15)22-8-6-21(3)7-9-22/h4-5,10,12-13,23H,6-9,11H2,1-3H3,(H2,19,20,24) |
| InChIKey | KJSYWCBDSUZAFL-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |