C21H27F2N3 — CID 119122933
1-[2-(4-ethylpiperazin-1-yl)-5-fluorophenyl]-N-[(4-fluorophenyl)methyl]ethanamine (PubChem CID 119122933) has the molecular formula C21H27F2N3 and a molecular weight of 359.46 g/mol. Its IUPAC name is 1-[2-(4-ethylpiperazin-1-yl)-5-fluorophenyl]-N-[(4-fluorophenyl)methyl]ethanamine.
| Compound Name | 1-[2-(4-ethylpiperazin-1-yl)-5-fluorophenyl]-N-[(4-fluorophenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 119122933 |
| Molecular Formula | C21H27F2N3 |
| Molecular Weight | 359.46 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | 1-[2-(4-ethylpiperazin-1-yl)-5-fluorophenyl]-N-[(4-fluorophenyl)methyl]ethanamine |
| SMILES | CCN1CCN(c2ccc(F)cc2C(C)NCc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C21H27F2N3/c1-3-25-10-12-26(13-11-25)21-9-8-19(23)14-20(21)16(2)24-15-17-4-6-18(22)7-5-17/h4-9,14,16,24H,3,10-13,15H2,1-2H3 |
| InChIKey | URICBPSTMCNDIW-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.46 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |