C18H14F2O4 — CID 3947201
1-[4-(difluoromethoxy)phenyl]-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-en-1-one (PubChem CID 3947201) has the molecular formula C18H14F2O4 and a molecular weight of 332.30 g/mol. Its IUPAC name is 1-[4-(difluoromethoxy)phenyl]-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-en-1-one.
| Compound Name | 1-[4-(difluoromethoxy)phenyl]-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 3947201 |
| Molecular Formula | C18H14F2O4 |
| Molecular Weight | 332.30 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 1-[4-(difluoromethoxy)phenyl]-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-en-1-one |
| SMILES | O=C(C=Cc1ccc2c(c1)OCCO2)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C18H14F2O4/c19-18(20)24-14-5-3-13(4-6-14)15(21)7-1-12-2-8-16-17(11-12)23-10-9-22-16/h1-8,11,18H,9-10H2 |
| InChIKey | TVUJYMRJKWIABE-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.30 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|