C33H42N2O2 — CID 69214903
3-[2-[4-(diethylamino)butoxy]-5-(2-methylphenyl)phenyl]-1-[2-[(dimethylamino)methyl]phenyl]prop-2-en-1-one (PubChem CID 69214903) has the molecular formula C33H42N2O2 and a molecular weight of 498.71 g/mol. Its IUPAC name is 3-[2-[4-(diethylamino)butoxy]-5-(2-methylphenyl)phenyl]-1-[2-[(dimethylamino)methyl]phenyl]prop-2-en-1-one.
| Compound Name | 3-[2-[4-(diethylamino)butoxy]-5-(2-methylphenyl)phenyl]-1-[2-[(dimethylamino)methyl]phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 69214903 |
| Molecular Formula | C33H42N2O2 |
| Molecular Weight | 498.71 g/mol |
| Exact Mass | 498.32 |
| IUPAC Name | 3-[2-[4-(diethylamino)butoxy]-5-(2-methylphenyl)phenyl]-1-[2-[(dimethylamino)methyl]phenyl]prop-2-en-1-one |
| SMILES | CCN(CC)CCCCOc1ccc(-c2ccccc2C)cc1C=CC(=O)c1ccccc1CN(C)C |
| InChI | InChI=1S/C33H42N2O2/c1-6-35(7-2)22-12-13-23-37-33-21-19-27(30-16-10-8-14-26(30)3)24-28(33)18-20-32(36)31-17-11-9-15-29(31)25-34(4)5/h8-11,14-21,24H,6-7,12-13,22-23,25H2,1-5H3 |
| InChIKey | KVNLLCANRHBEGC-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.71 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|