C19H20FNO2 — CID 10380856
(E)-1-[2-[(dimethylamino)methyl]phenyl]-3-(2-fluoro-4-methoxyphenyl)prop-2-en-1-one (PubChem CID 10380856) has the molecular formula C19H20FNO2 and a molecular weight of 313.37 g/mol. Its IUPAC name is (E)-1-[2-[(dimethylamino)methyl]phenyl]-3-(2-fluoro-4-methoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[2-[(dimethylamino)methyl]phenyl]-3-(2-fluoro-4-methoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 10380856 |
| Molecular Formula | C19H20FNO2 |
| Molecular Weight | 313.37 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | (E)-1-[2-[(dimethylamino)methyl]phenyl]-3-(2-fluoro-4-methoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)c2ccccc2CN(C)C)c(F)c1 |
| InChI | InChI=1S/C19H20FNO2/c1-21(2)13-15-6-4-5-7-17(15)19(22)11-9-14-8-10-16(23-3)12-18(14)20/h4-12H,13H2,1-3H3/b11-9+ |
| InChIKey | AGPHDYJMNMZOLT-PKNBQFBNSA-N |
| XLogP | 3.79 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.37 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|