C17H15FO5 — CID 5471282
(E)-1-(2,5-dimethoxyphenyl)-3-(2-fluoro-4,5-dihydroxyphenyl)prop-2-en-1-one (PubChem CID 5471282) has the molecular formula C17H15FO5 and a molecular weight of 318.30 g/mol. Its IUPAC name is (E)-1-(2,5-dimethoxyphenyl)-3-(2-fluoro-4,5-dihydroxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(2,5-dimethoxyphenyl)-3-(2-fluoro-4,5-dihydroxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 5471282 |
| Molecular Formula | C17H15FO5 |
| Molecular Weight | 318.30 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | (E)-1-(2,5-dimethoxyphenyl)-3-(2-fluoro-4,5-dihydroxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(OC)c(C(=O)/C=C/c2cc(O)c(O)cc2F)c1 |
| InChI | InChI=1S/C17H15FO5/c1-22-11-4-6-17(23-2)12(8-11)14(19)5-3-10-7-15(20)16(21)9-13(10)18/h3-9,20-21H,1-2H3/b5-3+ |
| InChIKey | UCLVFWWQFRKWSS-HWKANZROSA-N |
| XLogP | 3.15 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.30 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|