C21H18F2O4 — CID 59695569
(1E,4Z,6E)-1,7-bis(2-fluoro-4-methoxyphenyl)-5-hydroxyhepta-1,4,6-trien-3-one (PubChem CID 59695569) has the molecular formula C21H18F2O4 and a molecular weight of 372.37 g/mol. Its IUPAC name is (1E,4Z,6E)-1,7-bis(2-fluoro-4-methoxyphenyl)-5-hydroxyhepta-1,4,6-trien-3-one.
| Compound Name | (1E,4Z,6E)-1,7-bis(2-fluoro-4-methoxyphenyl)-5-hydroxyhepta-1,4,6-trien-3-one |
|---|---|
| PubChem CID | 59695569 |
| Molecular Formula | C21H18F2O4 |
| Molecular Weight | 372.37 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | (1E,4Z,6E)-1,7-bis(2-fluoro-4-methoxyphenyl)-5-hydroxyhepta-1,4,6-trien-3-one |
| SMILES | COc1ccc(/C=C/C(=O)/C=C(O)/C=C/c2ccc(OC)cc2F)c(F)c1 |
| InChI | InChI=1S/C21H18F2O4/c1-26-18-9-5-14(20(22)12-18)3-7-16(24)11-17(25)8-4-15-6-10-19(27-2)13-21(15)23/h3-13,24H,1-2H3/b7-3+,8-4+,16-11- |
| InChIKey | XZWLKOYMSMRFOJ-BNBZNRLZSA-N |
| XLogP | 4.72 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.37 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|