C21H20O6 — CID 88559652
(1E,4Z,6E)-5-hydroxy-1-[2-hydroxy-4-(hydroxymethyl)phenyl]-7-(2-hydroxy-4-methoxyphenyl)hepta-1,4,6-trien-3-one (PubChem CID 88559652) has the molecular formula C21H20O6 and a molecular weight of 368.39 g/mol. Its IUPAC name is (1E,4Z,6E)-5-hydroxy-1-[2-hydroxy-4-(hydroxymethyl)phenyl]-7-(2-hydroxy-4-methoxyphenyl)hepta-1,4,6-trien-3-one.
| Compound Name | (1E,4Z,6E)-5-hydroxy-1-[2-hydroxy-4-(hydroxymethyl)phenyl]-7-(2-hydroxy-4-methoxyphenyl)hepta-1,4,6-trien-3-one |
|---|---|
| PubChem CID | 88559652 |
| Molecular Formula | C21H20O6 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | (1E,4Z,6E)-5-hydroxy-1-[2-hydroxy-4-(hydroxymethyl)phenyl]-7-(2-hydroxy-4-methoxyphenyl)hepta-1,4,6-trien-3-one |
| SMILES | COc1ccc(/C=C/C(O)=C/C(=O)/C=C/c2ccc(CO)cc2O)c(O)c1 |
| InChI | InChI=1S/C21H20O6/c1-27-19-9-6-16(21(26)12-19)5-8-18(24)11-17(23)7-4-15-3-2-14(13-22)10-20(15)25/h2-12,22,24-26H,13H2,1H3/b7-4+,8-5+,18-11- |
| InChIKey | FLISYWUHSATDHQ-MGAKGEGGSA-N |
| XLogP | 3.34 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|