C19H16Br2O3 — CID 85469362
(1E,4E)-1,5-bis(2-bromo-5-methoxyphenyl)penta-1,4-dien-3-one (PubChem CID 85469362) has the molecular formula C19H16Br2O3 and a molecular weight of 452.14 g/mol. Its IUPAC name is (1E,4E)-1,5-bis(2-bromo-5-methoxyphenyl)penta-1,4-dien-3-one.
| Compound Name | (1E,4E)-1,5-bis(2-bromo-5-methoxyphenyl)penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 85469362 |
| Molecular Formula | C19H16Br2O3 |
| Molecular Weight | 452.14 g/mol |
| Exact Mass | 449.95 |
| IUPAC Name | (1E,4E)-1,5-bis(2-bromo-5-methoxyphenyl)penta-1,4-dien-3-one |
| SMILES | COc1ccc(Br)c(/C=C/C(=O)/C=C/c2cc(OC)ccc2Br)c1 |
| InChI | InChI=1S/C19H16Br2O3/c1-23-16-7-9-18(20)13(11-16)3-5-15(22)6-4-14-12-17(24-2)8-10-19(14)21/h3-12H,1-2H3/b5-3+,6-4+ |
| InChIKey | GRQOZEFEEVRBOX-GGWOSOGESA-N |
| XLogP | 5.52 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.14 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|