C12H13BrO4 — CID 126513471
(2S)-4-(2-bromo-5-methoxyphenyl)-2-(hydroxymethyl)but-3-enoic acid (PubChem CID 126513471) has the molecular formula C12H13BrO4 and a molecular weight of 301.14 g/mol. Its IUPAC name is (2S)-4-(2-bromo-5-methoxyphenyl)-2-(hydroxymethyl)but-3-enoic acid.
| Compound Name | (2S)-4-(2-bromo-5-methoxyphenyl)-2-(hydroxymethyl)but-3-enoic acid |
|---|---|
| PubChem CID | 126513471 |
| Molecular Formula | C12H13BrO4 |
| Molecular Weight | 301.14 g/mol |
| Exact Mass | 300.00 |
| IUPAC Name | (2S)-4-(2-bromo-5-methoxyphenyl)-2-(hydroxymethyl)but-3-enoic acid |
| SMILES | COc1ccc(Br)c(C=C[C@@H](CO)C(=O)O)c1 |
| InChI | InChI=1S/C12H13BrO4/c1-17-10-4-5-11(13)8(6-10)2-3-9(7-14)12(15)16/h2-6,9,14H,7H2,1H3,(H,15,16)/t9-/m0/s1 |
| InChIKey | DTXWAZBHHPHINE-VIFPVBQESA-N |
| XLogP | 2.16 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.14 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |