C28H33N2O2+ — CID 11421556
2-[2-[(E)-3-(4-aminophenyl)-3-oxoprop-1-enyl]-4-(3,5-dimethylphenyl)phenoxy]ethyl-trimethylazanium (PubChem CID 11421556) has the molecular formula C28H33N2O2+ and a molecular weight of 429.58 g/mol. Its IUPAC name is 2-[2-[(E)-3-(4-aminophenyl)-3-oxoprop-1-enyl]-4-(3,5-dimethylphenyl)phenoxy]ethyl-trimethylazanium.
| Compound Name | 2-[2-[(E)-3-(4-aminophenyl)-3-oxoprop-1-enyl]-4-(3,5-dimethylphenyl)phenoxy]ethyl-trimethylazanium |
|---|---|
| PubChem CID | 11421556 |
| Molecular Formula | C28H33N2O2+ |
| Molecular Weight | 429.58 g/mol |
| Exact Mass | 429.25 |
| IUPAC Name | 2-[2-[(E)-3-(4-aminophenyl)-3-oxoprop-1-enyl]-4-(3,5-dimethylphenyl)phenoxy]ethyl-trimethylazanium |
| SMILES | Cc1cc(C)cc(-c2ccc(OCC[N+](C)(C)C)c(/C=C/C(=O)c3ccc(N)cc3)c2)c1 |
| InChI | InChI=1S/C28H32N2O2/c1-20-16-21(2)18-25(17-20)23-9-13-28(32-15-14-30(3,4)5)24(19-23)8-12-27(31)22-6-10-26(29)11-7-22/h6-13,16-19H,14-15H2,1-5H3,(H-,29,31)/p+1/b12-8+ |
| InChIKey | INIZXOWRAIIOGR-XYOKQWHBSA-O |
| XLogP | 5.53 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.58 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|