C32H42N2O2+2 — CID 143042008
dimethyl-[2-[2-[(E)-3-oxo-3-[3-[(trimethylazaniumyl)methyl]phenyl]prop-1-enyl]-4-phenylphenoxy]ethyl]-propan-2-ylazanium (PubChem CID 143042008) has the molecular formula C32H42N2O2+2 and a molecular weight of 486.70 g/mol. Its IUPAC name is dimethyl-[2-[2-[(E)-3-oxo-3-[3-[(trimethylazaniumyl)methyl]phenyl]prop-1-enyl]-4-phenylphenoxy]ethyl]-propan-2-ylazanium.
| Compound Name | dimethyl-[2-[2-[(E)-3-oxo-3-[3-[(trimethylazaniumyl)methyl]phenyl]prop-1-enyl]-4-phenylphenoxy]ethyl]-propan-2-ylazanium |
|---|---|
| PubChem CID | 143042008 |
| Molecular Formula | C32H42N2O2+2 |
| Molecular Weight | 486.70 g/mol |
| Exact Mass | 486.32 |
| IUPAC Name | dimethyl-[2-[2-[(E)-3-oxo-3-[3-[(trimethylazaniumyl)methyl]phenyl]prop-1-enyl]-4-phenylphenoxy]ethyl]-propan-2-ylazanium |
| SMILES | CC(C)[N+](C)(C)CCOc1ccc(-c2ccccc2)cc1/C=C/C(=O)c1cccc(C[N+](C)(C)C)c1 |
| InChI | InChI=1S/C32H42N2O2/c1-25(2)34(6,7)20-21-36-32-19-17-28(27-13-9-8-10-14-27)23-30(32)16-18-31(35)29-15-11-12-26(22-29)24-33(3,4)5/h8-19,22-23,25H,20-21,24H2,1-7H3/q+2/b18-16+ |
| InChIKey | IEAFNSWXPNPRQP-FBMGVBCBSA-N |
| XLogP | 6.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.70 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|