C11H10BrN4O2S- — CID 163879048
[4-(3-bromoanilino)-2-methylsulfanylpyrimidin-5-yl]-dioxidoazanium (PubChem CID 163879048) has the molecular formula C11H10BrN4O2S- and a molecular weight of 342.20 g/mol. Its IUPAC name is [4-(3-bromoanilino)-2-methylsulfanylpyrimidin-5-yl]-dioxidoazanium.
| Compound Name | [4-(3-bromoanilino)-2-methylsulfanylpyrimidin-5-yl]-dioxidoazanium |
|---|---|
| PubChem CID | 163879048 |
| Molecular Formula | C11H10BrN4O2S- |
| Molecular Weight | 342.20 g/mol |
| Exact Mass | 340.97 |
| IUPAC Name | [4-(3-bromoanilino)-2-methylsulfanylpyrimidin-5-yl]-dioxidoazanium |
| SMILES | CSc1ncc([NH+]([O-])[O-])c(Nc2cccc(Br)c2)n1 |
| InChI | InChI=1S/C11H10BrN4O2S/c1-19-11-13-6-9(16(17)18)10(15-11)14-8-4-2-3-7(12)5-8/h2-6,16H,1H3,(H,13,14,15)/q-1 |
| InChIKey | PRLZUBNKFJHAKH-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 88.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.20 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|