C16H19N3O3S — CID 141021256
ethyl 2-[3-[[5-(hydroxymethyl)-2-methylsulfanylpyrimidin-4-yl]amino]phenyl]acetate (PubChem CID 141021256) has the molecular formula C16H19N3O3S and a molecular weight of 333.41 g/mol. Its IUPAC name is ethyl 2-[3-[[5-(hydroxymethyl)-2-methylsulfanylpyrimidin-4-yl]amino]phenyl]acetate.
| Compound Name | ethyl 2-[3-[[5-(hydroxymethyl)-2-methylsulfanylpyrimidin-4-yl]amino]phenyl]acetate |
|---|---|
| PubChem CID | 141021256 |
| Molecular Formula | C16H19N3O3S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | ethyl 2-[3-[[5-(hydroxymethyl)-2-methylsulfanylpyrimidin-4-yl]amino]phenyl]acetate |
| SMILES | CCOC(=O)Cc1cccc(Nc2nc(SC)ncc2CO)c1 |
| InChI | InChI=1S/C16H19N3O3S/c1-3-22-14(21)8-11-5-4-6-13(7-11)18-15-12(10-20)9-17-16(19-15)23-2/h4-7,9,20H,3,8,10H2,1-2H3,(H,17,18,19) |
| InChIKey | RUBSPFPHMFPJMX-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |