C17H16N4O3S — CID 171546889
ethyl 3-(4-anilino-2-methylsulfanylpyrimidin-5-yl)-2-cyano-3-oxopropanoate (PubChem CID 171546889) has the molecular formula C17H16N4O3S and a molecular weight of 356.41 g/mol. Its IUPAC name is ethyl 3-(4-anilino-2-methylsulfanylpyrimidin-5-yl)-2-cyano-3-oxopropanoate.
| Compound Name | ethyl 3-(4-anilino-2-methylsulfanylpyrimidin-5-yl)-2-cyano-3-oxopropanoate |
|---|---|
| PubChem CID | 171546889 |
| Molecular Formula | C17H16N4O3S |
| Molecular Weight | 356.41 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | ethyl 3-(4-anilino-2-methylsulfanylpyrimidin-5-yl)-2-cyano-3-oxopropanoate |
| SMILES | CCOC(=O)C(C#N)C(=O)c1cnc(SC)nc1Nc1ccccc1 |
| InChI | InChI=1S/C17H16N4O3S/c1-3-24-16(23)12(9-18)14(22)13-10-19-17(25-2)21-15(13)20-11-7-5-4-6-8-11/h4-8,10,12H,3H2,1-2H3,(H,19,20,21) |
| InChIKey | LJSLVXKOHMUHTA-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 104.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.41 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|