About 5-bromo-N-(3,4-dichlorophenyl)-2-methylsulfanylpyrimidin-4-amine;hydrochloride
5-bromo-N-(3,4-dichlorophenyl)-2-methylsulfanylpyrimidin-4-amine;hydrochloride (PubChem CID 54605390) has the molecular formula C11H9BrCl3N3S
and a molecular weight of 401.54 g/mol. Its IUPAC name is 5-bromo-N-(3,4-dichlorophenyl)-2-methylsulfanylpyrimidin-4-amine;hydrochloride.
Molecular Properties
| Compound Name | 5-bromo-N-(3,4-dichlorophenyl)-2-methylsulfanylpyrimidin-4-amine;hydrochloride |
| PubChem CID | 54605390 |
| Molecular Formula | C11H9BrCl3N3S |
| Molecular Weight | 401.54 g/mol |
| Exact Mass | 398.88 |
| IUPAC Name | 5-bromo-N-(3,4-dichlorophenyl)-2-methylsulfanylpyrimidin-4-amine;hydrochloride |
| SMILES | CSc1ncc(Br)c(Nc2ccc(Cl)c(Cl)c2)n1.Cl |
| InChI | InChI=1S/C11H8BrCl2N3S.ClH/c1-18-11-15-5-7(12)10(17-11)16-6-2-3-8(13)9(14)4-6;/h2-5H,1H3,(H,15,16,17);1H |
| InChIKey | XNPRDSMPMKQZHE-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 401.54 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-bromo-N-(3,4-dichlorophenyl)-2-methylsulfanylpyrimidin-4-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N-(3,4-dichlorophenyl)-2-methylsulfanylpyrimidin-4-amine;hydrochloride?
The IUPAC name of 5-bromo-N-(3,4-dichlorophenyl)-2-methylsulfanylpyrimidin-4-amine;hydrochloride (CID 54605390) is 5-bromo-N-(3,4-dichlorophenyl)-2-methylsulfanylpyrimidin-4-amine;hydrochloride.
What is the SMILES notation for 5-bromo-N-(3,4-dichlorophenyl)-2-methylsulfanylpyrimidin-4-amine;hydrochloride?
The canonical SMILES for 5-bromo-N-(3,4-dichlorophenyl)-2-methylsulfanylpyrimidin-4-amine;hydrochloride is CSc1ncc(Br)c(Nc2ccc(Cl)c(Cl)c2)n1.Cl.
What is the InChIKey of 5-bromo-N-(3,4-dichlorophenyl)-2-methylsulfanylpyrimidin-4-amine;hydrochloride?
The InChIKey is XNPRDSMPMKQZHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8BrCl2N3S.ClH/c1-18-11-15-5-7(12)10(17-11)16-6-2-3-8(13)9(14)4-6;/h2-5H,1H3,(H,15,16,17);1H.
What are the key properties of 5-bromo-N-(3,4-dichlorophenyl)-2-methylsulfanylpyrimidin-4-amine;hydrochloride?
5-bromo-N-(3,4-dichlorophenyl)-2-methylsulfanylpyrimidin-4-amine;hydrochloride has a molecular weight of 401.54 g/mol, XLogP of 5.43, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N-(3,4-dichlorophenyl)-2-methylsulfanylpyrimidin-4-amine;hydrochloride is sourced from PubChem (CID 54605390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).