C12H12ClN5S — CID 118579864
5-(1-aminoethenyl)-N-(6-chloro-3-pyridinyl)-2-methylsulfanylpyrimidin-4-amine (PubChem CID 118579864) has the molecular formula C12H12ClN5S and a molecular weight of 293.78 g/mol. Its IUPAC name is 5-(1-aminoethenyl)-N-(6-chloro-3-pyridinyl)-2-methylsulfanylpyrimidin-4-amine.
| Compound Name | 5-(1-aminoethenyl)-N-(6-chloro-3-pyridinyl)-2-methylsulfanylpyrimidin-4-amine |
|---|---|
| PubChem CID | 118579864 |
| Molecular Formula | C12H12ClN5S |
| Molecular Weight | 293.78 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 5-(1-aminoethenyl)-N-(6-chloro-3-pyridinyl)-2-methylsulfanylpyrimidin-4-amine |
| SMILES | C=C(N)c1cnc(SC)nc1Nc1ccc(Cl)nc1 |
| InChI | InChI=1S/C12H12ClN5S/c1-7(14)9-6-16-12(19-2)18-11(9)17-8-3-4-10(13)15-5-8/h3-6H,1,14H2,2H3,(H,16,17,18) |
| InChIKey | GJBDPEWZOSDEON-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.78 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|