C17H20N6O — CID 16910856
3-[[4-(3,4-dimethylanilino)pteridin-2-yl]amino]propan-1-ol (PubChem CID 16910856) has the molecular formula C17H20N6O and a molecular weight of 324.39 g/mol. Its IUPAC name is 3-[[4-(3,4-dimethylanilino)pteridin-2-yl]amino]propan-1-ol.
| Compound Name | 3-[[4-(3,4-dimethylanilino)pteridin-2-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 16910856 |
| Molecular Formula | C17H20N6O |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 3-[[4-(3,4-dimethylanilino)pteridin-2-yl]amino]propan-1-ol |
| SMILES | Cc1ccc(Nc2nc(NCCCO)nc3nccnc23)cc1C |
| InChI | InChI=1S/C17H20N6O/c1-11-4-5-13(10-12(11)2)21-16-14-15(19-8-7-18-14)22-17(23-16)20-6-3-9-24/h4-5,7-8,10,24H,3,6,9H2,1-2H3,(H2,19,20,21,22,23) |
| InChIKey | UEKWFSIIUUFOOH-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 95.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|