C22H30N6 — CID 16910879
2-N,2-N-dibutyl-4-N-(3,4-dimethylphenyl)pteridine-2,4-diamine (PubChem CID 16910879) has the molecular formula C22H30N6 and a molecular weight of 378.52 g/mol. Its IUPAC name is 2-N,2-N-dibutyl-4-N-(3,4-dimethylphenyl)pteridine-2,4-diamine.
| Compound Name | 2-N,2-N-dibutyl-4-N-(3,4-dimethylphenyl)pteridine-2,4-diamine |
|---|---|
| PubChem CID | 16910879 |
| Molecular Formula | C22H30N6 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.25 |
| IUPAC Name | 2-N,2-N-dibutyl-4-N-(3,4-dimethylphenyl)pteridine-2,4-diamine |
| SMILES | CCCCN(CCCC)c1nc(Nc2ccc(C)c(C)c2)c2nccnc2n1 |
| InChI | InChI=1S/C22H30N6/c1-5-7-13-28(14-8-6-2)22-26-20-19(23-11-12-24-20)21(27-22)25-18-10-9-16(3)17(4)15-18/h9-12,15H,5-8,13-14H2,1-4H3,(H,24,25,26,27) |
| InChIKey | XVRSTXIKMLLTFB-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 66.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |