C17H19FN6 — CID 16910636
2-N-butyl-4-N-(4-fluorophenyl)-2-N-methylpteridine-2,4-diamine (PubChem CID 16910636) has the molecular formula C17H19FN6 and a molecular weight of 326.38 g/mol. Its IUPAC name is 2-N-butyl-4-N-(4-fluorophenyl)-2-N-methylpteridine-2,4-diamine.
| Compound Name | 2-N-butyl-4-N-(4-fluorophenyl)-2-N-methylpteridine-2,4-diamine |
|---|---|
| PubChem CID | 16910636 |
| Molecular Formula | C17H19FN6 |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | 2-N-butyl-4-N-(4-fluorophenyl)-2-N-methylpteridine-2,4-diamine |
| SMILES | CCCCN(C)c1nc(Nc2ccc(F)cc2)c2nccnc2n1 |
| InChI | InChI=1S/C17H19FN6/c1-3-4-11-24(2)17-22-15-14(19-9-10-20-15)16(23-17)21-13-7-5-12(18)6-8-13/h5-10H,3-4,11H2,1-2H3,(H,20,21,22,23) |
| InChIKey | WXUFWVVLWUKWAJ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 66.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |