C17H17ClN6 — CID 16911025
N-(4-chloro-2-methylphenyl)-2-pyrrolidin-1-ylpteridin-4-amine (PubChem CID 16911025) has the molecular formula C17H17ClN6 and a molecular weight of 340.82 g/mol. Its IUPAC name is N-(4-chloro-2-methylphenyl)-2-pyrrolidin-1-ylpteridin-4-amine.
| Compound Name | N-(4-chloro-2-methylphenyl)-2-pyrrolidin-1-ylpteridin-4-amine |
|---|---|
| PubChem CID | 16911025 |
| Molecular Formula | C17H17ClN6 |
| Molecular Weight | 340.82 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | N-(4-chloro-2-methylphenyl)-2-pyrrolidin-1-ylpteridin-4-amine |
| SMILES | Cc1cc(Cl)ccc1Nc1nc(N2CCCC2)nc2nccnc12 |
| InChI | InChI=1S/C17H17ClN6/c1-11-10-12(18)4-5-13(11)21-16-14-15(20-7-6-19-14)22-17(23-16)24-8-2-3-9-24/h4-7,10H,2-3,8-9H2,1H3,(H,20,21,22,23) |
| InChIKey | YEDVNAYTNSVRDY-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 66.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.82 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |