C18H20N6O2S — CID 52904705
4-N-(2,5-dimethylphenyl)-2-N-[(3R)-1,1-dioxothiolan-3-yl]pteridine-2,4-diamine (PubChem CID 52904705) has the molecular formula C18H20N6O2S and a molecular weight of 384.47 g/mol. Its IUPAC name is 4-N-(2,5-dimethylphenyl)-2-N-[(3R)-1,1-dioxothiolan-3-yl]pteridine-2,4-diamine.
| Compound Name | 4-N-(2,5-dimethylphenyl)-2-N-[(3R)-1,1-dioxothiolan-3-yl]pteridine-2,4-diamine |
|---|---|
| PubChem CID | 52904705 |
| Molecular Formula | C18H20N6O2S |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 4-N-(2,5-dimethylphenyl)-2-N-[(3R)-1,1-dioxothiolan-3-yl]pteridine-2,4-diamine |
| SMILES | Cc1ccc(C)c(Nc2nc(N[C@@H]3CCS(=O)(=O)C3)nc3nccnc23)c1 |
| InChI | InChI=1S/C18H20N6O2S/c1-11-3-4-12(2)14(9-11)22-17-15-16(20-7-6-19-15)23-18(24-17)21-13-5-8-27(25,26)10-13/h3-4,6-7,9,13H,5,8,10H2,1-2H3,(H2,20,21,22,23,24)/t13-/m1/s1 |
| InChIKey | SBGHXPPWCQRVIK-CYBMUJFWSA-N |
| XLogP | 2.38 |
| TPSA | 109.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |