C20H26N8 — CID 71478220
N-benzyl-N'-[2-(4-methylpiperazin-1-yl)pteridin-4-yl]ethane-1,2-diamine (PubChem CID 71478220) has the molecular formula C20H26N8 and a molecular weight of 378.48 g/mol. Its IUPAC name is N-benzyl-N'-[2-(4-methylpiperazin-1-yl)pteridin-4-yl]ethane-1,2-diamine.
| Compound Name | N-benzyl-N'-[2-(4-methylpiperazin-1-yl)pteridin-4-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 71478220 |
| Molecular Formula | C20H26N8 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | N-benzyl-N'-[2-(4-methylpiperazin-1-yl)pteridin-4-yl]ethane-1,2-diamine |
| SMILES | CN1CCN(c2nc(NCCNCc3ccccc3)c3nccnc3n2)CC1 |
| InChI | InChI=1S/C20H26N8/c1-27-11-13-28(14-12-27)20-25-18(17-19(26-20)24-10-9-22-17)23-8-7-21-15-16-5-3-2-4-6-16/h2-6,9-10,21H,7-8,11-15H2,1H3,(H,23,24,25,26) |
| InChIKey | LJCWKEHJLOGYFA-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 82.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|