C17H24N6O3 — CID 133344695
N-[2-[[4-(azepan-1-yl)-6-methoxy-1,3,5-triazin-2-yl]amino]ethyl]furan-2-carboxamide (PubChem CID 133344695) has the molecular formula C17H24N6O3 and a molecular weight of 360.42 g/mol. Its IUPAC name is N-[2-[[4-(azepan-1-yl)-6-methoxy-1,3,5-triazin-2-yl]amino]ethyl]furan-2-carboxamide.
| Compound Name | N-[2-[[4-(azepan-1-yl)-6-methoxy-1,3,5-triazin-2-yl]amino]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 133344695 |
| Molecular Formula | C17H24N6O3 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | N-[2-[[4-(azepan-1-yl)-6-methoxy-1,3,5-triazin-2-yl]amino]ethyl]furan-2-carboxamide |
| SMILES | COc1nc(NCCNC(=O)c2ccco2)nc(N2CCCCCC2)n1 |
| InChI | InChI=1S/C17H24N6O3/c1-25-17-21-15(19-9-8-18-14(24)13-7-6-12-26-13)20-16(22-17)23-10-4-2-3-5-11-23/h6-7,12H,2-5,8-11H2,1H3,(H,18,24)(H,19,20,21,22) |
| InChIKey | GRPFYWJSWHIMLW-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 105.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|