C12H18N8 — CID 81006440
[6-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-2-ethyl-5-methylpyrimidin-4-yl]hydrazine (PubChem CID 81006440) has the molecular formula C12H18N8 and a molecular weight of 274.33 g/mol. Its IUPAC name is [6-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-2-ethyl-5-methylpyrimidin-4-yl]hydrazine.
| Compound Name | [6-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-2-ethyl-5-methylpyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 81006440 |
| Molecular Formula | C12H18N8 |
| Molecular Weight | 274.33 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | [6-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-2-ethyl-5-methylpyrimidin-4-yl]hydrazine |
| SMILES | CCc1nc(NN)c(C)c(N2CCn3cnnc3C2)n1 |
| InChI | InChI=1S/C12H18N8/c1-3-9-15-11(17-13)8(2)12(16-9)19-4-5-20-7-14-18-10(20)6-19/h7H,3-6,13H2,1-2H3,(H,15,16,17) |
| InChIKey | TYDORCBNMJHLKC-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 97.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.33 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|