C13H23N5S — CID 81007728
[6-(2,6-dimethylthiomorpholin-4-yl)-2-ethyl-5-methylpyrimidin-4-yl]hydrazine (PubChem CID 81007728) has the molecular formula C13H23N5S and a molecular weight of 281.43 g/mol. Its IUPAC name is [6-(2,6-dimethylthiomorpholin-4-yl)-2-ethyl-5-methylpyrimidin-4-yl]hydrazine.
| Compound Name | [6-(2,6-dimethylthiomorpholin-4-yl)-2-ethyl-5-methylpyrimidin-4-yl]hydrazine |
|---|---|
| PubChem CID | 81007728 |
| Molecular Formula | C13H23N5S |
| Molecular Weight | 281.43 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | [6-(2,6-dimethylthiomorpholin-4-yl)-2-ethyl-5-methylpyrimidin-4-yl]hydrazine |
| SMILES | CCc1nc(NN)c(C)c(N2CC(C)SC(C)C2)n1 |
| InChI | InChI=1S/C13H23N5S/c1-5-11-15-12(17-14)10(4)13(16-11)18-6-8(2)19-9(3)7-18/h8-9H,5-7,14H2,1-4H3,(H,15,16,17) |
| InChIKey | LXELEKSPSQXKOM-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.43 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|