C10H14N8 — CID 80837289
4-imidazol-1-yl-6-piperazin-1-yl-1,3,5-triazin-2-amine (PubChem CID 80837289) has the molecular formula C10H14N8 and a molecular weight of 246.28 g/mol. Its IUPAC name is 4-imidazol-1-yl-6-piperazin-1-yl-1,3,5-triazin-2-amine.
| Compound Name | 4-imidazol-1-yl-6-piperazin-1-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 80837289 |
| Molecular Formula | C10H14N8 |
| Molecular Weight | 246.28 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | 4-imidazol-1-yl-6-piperazin-1-yl-1,3,5-triazin-2-amine |
| SMILES | Nc1nc(N2CCNCC2)nc(-n2ccnc2)n1 |
| InChI | InChI=1S/C10H14N8/c11-8-14-9(17-4-1-12-2-5-17)16-10(15-8)18-6-3-13-7-18/h3,6-7,12H,1-2,4-5H2,(H2,11,14,15,16) |
| InChIKey | HXTZTLABBKSVGV-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 97.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.28 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |