C14H25ClN6 — CID 62869546
N-(4-chloro-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl)-N',N',2,2-tetramethylpropane-1,3-diamine (PubChem CID 62869546) has the molecular formula C14H25ClN6 and a molecular weight of 312.85 g/mol. Its IUPAC name is N-(4-chloro-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl)-N',N',2,2-tetramethylpropane-1,3-diamine.
| Compound Name | N-(4-chloro-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl)-N',N',2,2-tetramethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 62869546 |
| Molecular Formula | C14H25ClN6 |
| Molecular Weight | 312.85 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | N-(4-chloro-6-pyrrolidin-1-yl-1,3,5-triazin-2-yl)-N',N',2,2-tetramethylpropane-1,3-diamine |
| SMILES | CN(C)CC(C)(C)CNc1nc(Cl)nc(N2CCCC2)n1 |
| InChI | InChI=1S/C14H25ClN6/c1-14(2,10-20(3)4)9-16-12-17-11(15)18-13(19-12)21-7-5-6-8-21/h5-10H2,1-4H3,(H,16,17,18,19) |
| InChIKey | QPMORBLLRZCEFV-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.85 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |