C10H10Cl3N3O — CID 102750403
N-cyclopropyl-2-[(3,5,6-trichloro-2-pyridinyl)amino]acetamide (PubChem CID 102750403) has the molecular formula C10H10Cl3N3O and a molecular weight of 294.57 g/mol. Its IUPAC name is N-cyclopropyl-2-[(3,5,6-trichloro-2-pyridinyl)amino]acetamide.
| Compound Name | N-cyclopropyl-2-[(3,5,6-trichloro-2-pyridinyl)amino]acetamide |
|---|---|
| PubChem CID | 102750403 |
| Molecular Formula | C10H10Cl3N3O |
| Molecular Weight | 294.57 g/mol |
| Exact Mass | 292.99 |
| IUPAC Name | N-cyclopropyl-2-[(3,5,6-trichloro-2-pyridinyl)amino]acetamide |
| SMILES | O=C(CNc1nc(Cl)c(Cl)cc1Cl)NC1CC1 |
| InChI | InChI=1S/C10H10Cl3N3O/c11-6-3-7(12)10(16-9(6)13)14-4-8(17)15-5-1-2-5/h3,5H,1-2,4H2,(H,14,16)(H,15,17) |
| InChIKey | MZBFZAOPERIGBM-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.57 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|