C8H10ClN3OS — CID 130657605
2-[(5-chloro-1,3-thiazol-2-yl)amino]-N-cyclopropylacetamide (PubChem CID 130657605) has the molecular formula C8H10ClN3OS and a molecular weight of 231.71 g/mol. Its IUPAC name is 2-[(5-chloro-1,3-thiazol-2-yl)amino]-N-cyclopropylacetamide.
| Compound Name | 2-[(5-chloro-1,3-thiazol-2-yl)amino]-N-cyclopropylacetamide |
|---|---|
| PubChem CID | 130657605 |
| Molecular Formula | C8H10ClN3OS |
| Molecular Weight | 231.71 g/mol |
| Exact Mass | 231.02 |
| IUPAC Name | 2-[(5-chloro-1,3-thiazol-2-yl)amino]-N-cyclopropylacetamide |
| SMILES | O=C(CNc1ncc(Cl)s1)NC1CC1 |
| InChI | InChI=1S/C8H10ClN3OS/c9-6-3-10-8(14-6)11-4-7(13)12-5-1-2-5/h3,5H,1-2,4H2,(H,10,11)(H,12,13) |
| InChIKey | FAATXIQIYCVIJP-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.71 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |