C17H23BrN2S — CID 82787613
3-bromo-4-[(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]benzenecarbothioamide (PubChem CID 82787613) has the molecular formula C17H23BrN2S and a molecular weight of 367.36 g/mol. Its IUPAC name is 3-bromo-4-[(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]benzenecarbothioamide.
| Compound Name | 3-bromo-4-[(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]benzenecarbothioamide |
|---|---|
| PubChem CID | 82787613 |
| Molecular Formula | C17H23BrN2S |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | 3-bromo-4-[(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)amino]benzenecarbothioamide |
| SMILES | CC12CCC(C1)C(C)(C)C2Nc1ccc(C(N)=S)cc1Br |
| InChI | InChI=1S/C17H23BrN2S/c1-16(2)11-6-7-17(3,9-11)15(16)20-13-5-4-10(14(19)21)8-12(13)18/h4-5,8,11,15,20H,6-7,9H2,1-3H3,(H2,19,21) |
| InChIKey | HVUWIBQGXPYVOE-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|