C11H19N3S — CID 103970472
N-[[1-(aminomethyl)cyclohexyl]methyl]-1,3-thiazol-2-amine (PubChem CID 103970472) has the molecular formula C11H19N3S and a molecular weight of 225.36 g/mol. Its IUPAC name is N-[[1-(aminomethyl)cyclohexyl]methyl]-1,3-thiazol-2-amine.
| Compound Name | N-[[1-(aminomethyl)cyclohexyl]methyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 103970472 |
| Molecular Formula | C11H19N3S |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | N-[[1-(aminomethyl)cyclohexyl]methyl]-1,3-thiazol-2-amine |
| SMILES | NCC1(CNc2nccs2)CCCCC1 |
| InChI | InChI=1S/C11H19N3S/c12-8-11(4-2-1-3-5-11)9-14-10-13-6-7-15-10/h6-7H,1-5,8-9,12H2,(H,13,14) |
| InChIKey | VYPLYBORODBMFC-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |