C13H21N3 — CID 103970402
N-[[1-(aminomethyl)cyclohexyl]methyl]pyridin-2-amine (PubChem CID 103970402) has the molecular formula C13H21N3 and a molecular weight of 219.33 g/mol. Its IUPAC name is N-[[1-(aminomethyl)cyclohexyl]methyl]pyridin-2-amine.
| Compound Name | N-[[1-(aminomethyl)cyclohexyl]methyl]pyridin-2-amine |
|---|---|
| PubChem CID | 103970402 |
| Molecular Formula | C13H21N3 |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.17 |
| IUPAC Name | N-[[1-(aminomethyl)cyclohexyl]methyl]pyridin-2-amine |
| SMILES | NCC1(CNc2ccccn2)CCCCC1 |
| InChI | InChI=1S/C13H21N3/c14-10-13(7-3-1-4-8-13)11-16-12-6-2-5-9-15-12/h2,5-6,9H,1,3-4,7-8,10-11,14H2,(H,15,16) |
| InChIKey | ZKZSUOUNOCIDKL-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |