2,2-difluorocyclohexan-1-amine;formic acid

C7H13F2NO2 — CID 126843056

IUPAC2,2-difluorocyclohexan-1-amine;formic acid
SMILESNC1CCCCC1(F)F.O=CO
InChIInChI=1S/C6H11F2N.CH2O2/c7-6(8)4-2-1-3-5(6)9;2-1-3/h5H,1-4,9H2;1H,(H,2,3)
InChIKeySSBLOLSYTKKNIH-UHFFFAOYSA-N
MW181.18 g/mol
LogP1.22
Rot. Bonds

About 2,2-difluorocyclohexan-1-amine;formic acid

2,2-difluorocyclohexan-1-amine;formic acid (PubChem CID 126843056) has the molecular formula C7H13F2NO2 and a molecular weight of 181.18 g/mol. Its IUPAC name is 2,2-difluorocyclohexan-1-amine;formic acid.

Molecular Properties

Compound Name2,2-difluorocyclohexan-1-amine;formic acid
PubChem CID126843056
Molecular FormulaC7H13F2NO2
Molecular Weight181.18 g/mol
Exact Mass181.09
IUPAC Name2,2-difluorocyclohexan-1-amine;formic acid
SMILESNC1CCCCC1(F)F.O=CO
InChIInChI=1S/C6H11F2N.CH2O2/c7-6(8)4-2-1-3-5(6)9;2-1-3/h5H,1-4,9H2;1H,(H,2,3)
InChIKeySSBLOLSYTKKNIH-UHFFFAOYSA-N
XLogP1.22
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500181.18
LogP ≤ 51.22
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze 2,2-difluorocyclohexan-1-amine;formic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,2-difluorocyclohexan-1-amine;formic acid?
The IUPAC name of 2,2-difluorocyclohexan-1-amine;formic acid (CID 126843056) is 2,2-difluorocyclohexan-1-amine;formic acid.
What is the SMILES notation for 2,2-difluorocyclohexan-1-amine;formic acid?
The canonical SMILES for 2,2-difluorocyclohexan-1-amine;formic acid is NC1CCCCC1(F)F.O=CO.
What is the InChIKey of 2,2-difluorocyclohexan-1-amine;formic acid?
The InChIKey is SSBLOLSYTKKNIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11F2N.CH2O2/c7-6(8)4-2-1-3-5(6)9;2-1-3/h5H,1-4,9H2;1H,(H,2,3).
What are the key properties of 2,2-difluorocyclohexan-1-amine;formic acid?
2,2-difluorocyclohexan-1-amine;formic acid has a molecular weight of 181.18 g/mol, XLogP of 1.22, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluorocyclohexan-1-amine;formic acid is sourced from PubChem (CID 126843056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).