C7H13F2NO2 — CID 126843056
2,2-difluorocyclohexan-1-amine;formic acid (PubChem CID 126843056) has the molecular formula C7H13F2NO2 and a molecular weight of 181.18 g/mol. Its IUPAC name is 2,2-difluorocyclohexan-1-amine;formic acid.
| Compound Name | 2,2-difluorocyclohexan-1-amine;formic acid |
|---|---|
| PubChem CID | 126843056 |
| Molecular Formula | C7H13F2NO2 |
| Molecular Weight | 181.18 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 2,2-difluorocyclohexan-1-amine;formic acid |
| SMILES | NC1CCCCC1(F)F.O=CO |
| InChI | InChI=1S/C6H11F2N.CH2O2/c7-6(8)4-2-1-3-5(6)9;2-1-3/h5H,1-4,9H2;1H,(H,2,3) |
| InChIKey | SSBLOLSYTKKNIH-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.18 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|