C7H12F2N2O — CID 131126356
(2,2-difluorocyclohexyl)urea (PubChem CID 131126356) has the molecular formula C7H12F2N2O and a molecular weight of 178.18 g/mol. Its IUPAC name is (2,2-difluorocyclohexyl)urea.
| Compound Name | (2,2-difluorocyclohexyl)urea |
|---|---|
| PubChem CID | 131126356 |
| Molecular Formula | C7H12F2N2O |
| Molecular Weight | 178.18 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | (2,2-difluorocyclohexyl)urea |
| SMILES | NC(=O)NC1CCCCC1(F)F |
| InChI | InChI=1S/C7H12F2N2O/c8-7(9)4-2-1-3-5(7)11-6(10)12/h5H,1-4H2,(H3,10,11,12) |
| InChIKey | HUILWEVPQIUJPS-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.18 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |