C12H18F2N2O — CID 141395671
N-[(1S)-2,2-difluorocyclohexyl]-1-azabicyclo[3.1.0]hexane-3-carboxamide (PubChem CID 141395671) has the molecular formula C12H18F2N2O and a molecular weight of 244.28 g/mol. Its IUPAC name is N-[(1S)-2,2-difluorocyclohexyl]-1-azabicyclo[3.1.0]hexane-3-carboxamide.
| Compound Name | N-[(1S)-2,2-difluorocyclohexyl]-1-azabicyclo[3.1.0]hexane-3-carboxamide |
|---|---|
| PubChem CID | 141395671 |
| Molecular Formula | C12H18F2N2O |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.14 |
| IUPAC Name | N-[(1S)-2,2-difluorocyclohexyl]-1-azabicyclo[3.1.0]hexane-3-carboxamide |
| SMILES | O=C(N[C@H]1CCCCC1(F)F)C1CC2CN2C1 |
| InChI | InChI=1S/C12H18F2N2O/c13-12(14)4-2-1-3-10(12)15-11(17)8-5-9-7-16(9)6-8/h8-10H,1-7H2,(H,15,17)/t8?,9?,10-,16?/m0/s1 |
| InChIKey | GMVMPXOBYHQDSA-WWXPEIAOSA-N |
| XLogP | 1.38 |
| TPSA | 32.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|