C9H16F2N2O — CID 130942417
(2S)-2-amino-N-(2,2-difluorocyclohexyl)propanamide (PubChem CID 130942417) has the molecular formula C9H16F2N2O and a molecular weight of 206.24 g/mol. Its IUPAC name is (2S)-2-amino-N-(2,2-difluorocyclohexyl)propanamide.
| Compound Name | (2S)-2-amino-N-(2,2-difluorocyclohexyl)propanamide |
|---|---|
| PubChem CID | 130942417 |
| Molecular Formula | C9H16F2N2O |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | (2S)-2-amino-N-(2,2-difluorocyclohexyl)propanamide |
| SMILES | C[C@H](N)C(=O)NC1CCCCC1(F)F |
| InChI | InChI=1S/C9H16F2N2O/c1-6(12)8(14)13-7-4-2-3-5-9(7,10)11/h6-7H,2-5,12H2,1H3,(H,13,14)/t6-,7?/m0/s1 |
| InChIKey | PWDKCCFYBISMNQ-PKPIPKONSA-N |
| XLogP | 1.03 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |