C7H14ClF2N — CID 105441933
(2,2-difluorocyclohexyl)methanamine;hydrochloride (PubChem CID 105441933) has the molecular formula C7H14ClF2N and a molecular weight of 185.64 g/mol. Its IUPAC name is (2,2-difluorocyclohexyl)methanamine;hydrochloride.
| Compound Name | (2,2-difluorocyclohexyl)methanamine;hydrochloride |
|---|---|
| PubChem CID | 105441933 |
| Molecular Formula | C7H14ClF2N |
| Molecular Weight | 185.64 g/mol |
| Exact Mass | 185.08 |
| IUPAC Name | (2,2-difluorocyclohexyl)methanamine;hydrochloride |
| SMILES | Cl.NCC1CCCCC1(F)F |
| InChI | InChI=1S/C7H13F2N.ClH/c8-7(9)4-2-1-3-6(7)5-10;/h6H,1-5,10H2;1H |
| InChIKey | CKYLHKNEFAMPOL-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.64 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |