C10H16BrNO3S — CID 80659982
(3-bromopiperidin-1-yl)-(1,1-dioxothiolan-3-yl)methanone (PubChem CID 80659982) has the molecular formula C10H16BrNO3S and a molecular weight of 310.21 g/mol. Its IUPAC name is (3-bromopiperidin-1-yl)-(1,1-dioxothiolan-3-yl)methanone.
| Compound Name | (3-bromopiperidin-1-yl)-(1,1-dioxothiolan-3-yl)methanone |
|---|---|
| PubChem CID | 80659982 |
| Molecular Formula | C10H16BrNO3S |
| Molecular Weight | 310.21 g/mol |
| Exact Mass | 309.00 |
| IUPAC Name | (3-bromopiperidin-1-yl)-(1,1-dioxothiolan-3-yl)methanone |
| SMILES | O=C(C1CCS(=O)(=O)C1)N1CCCC(Br)C1 |
| InChI | InChI=1S/C10H16BrNO3S/c11-9-2-1-4-12(6-9)10(13)8-3-5-16(14,15)7-8/h8-9H,1-7H2 |
| InChIKey | DIYIGNDSUMHFTP-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.21 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|