C10H16BrNO4S — CID 81210830
[2-(bromomethyl)morpholin-4-yl]-(1,1-dioxothiolan-3-yl)methanone (PubChem CID 81210830) has the molecular formula C10H16BrNO4S and a molecular weight of 326.21 g/mol. Its IUPAC name is [2-(bromomethyl)morpholin-4-yl]-(1,1-dioxothiolan-3-yl)methanone.
| Compound Name | [2-(bromomethyl)morpholin-4-yl]-(1,1-dioxothiolan-3-yl)methanone |
|---|---|
| PubChem CID | 81210830 |
| Molecular Formula | C10H16BrNO4S |
| Molecular Weight | 326.21 g/mol |
| Exact Mass | 325.00 |
| IUPAC Name | [2-(bromomethyl)morpholin-4-yl]-(1,1-dioxothiolan-3-yl)methanone |
| SMILES | O=C(C1CCS(=O)(=O)C1)N1CCOC(CBr)C1 |
| InChI | InChI=1S/C10H16BrNO4S/c11-5-9-6-12(2-3-16-9)10(13)8-1-4-17(14,15)7-8/h8-9H,1-7H2 |
| InChIKey | CKJBBEQQYPHRAO-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.21 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|