C10H18BrNO2 — CID 81211878
1-[2-(bromomethyl)morpholin-4-yl]-2,2-dimethylpropan-1-one (PubChem CID 81211878) has the molecular formula C10H18BrNO2 and a molecular weight of 264.16 g/mol. Its IUPAC name is 1-[2-(bromomethyl)morpholin-4-yl]-2,2-dimethylpropan-1-one.
| Compound Name | 1-[2-(bromomethyl)morpholin-4-yl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 81211878 |
| Molecular Formula | C10H18BrNO2 |
| Molecular Weight | 264.16 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | 1-[2-(bromomethyl)morpholin-4-yl]-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(C)C(=O)N1CCOC(CBr)C1 |
| InChI | InChI=1S/C10H18BrNO2/c1-10(2,3)9(13)12-4-5-14-8(6-11)7-12/h8H,4-7H2,1-3H3 |
| InChIKey | SEXVILZRNDBLSP-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.16 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|