C10H19NO5S — CID 81209184
1-[2-(hydroxymethyl)morpholin-4-yl]-2-methyl-2-methylsulfonylpropan-1-one (PubChem CID 81209184) has the molecular formula C10H19NO5S and a molecular weight of 265.33 g/mol. Its IUPAC name is 1-[2-(hydroxymethyl)morpholin-4-yl]-2-methyl-2-methylsulfonylpropan-1-one.
| Compound Name | 1-[2-(hydroxymethyl)morpholin-4-yl]-2-methyl-2-methylsulfonylpropan-1-one |
|---|---|
| PubChem CID | 81209184 |
| Molecular Formula | C10H19NO5S |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 1-[2-(hydroxymethyl)morpholin-4-yl]-2-methyl-2-methylsulfonylpropan-1-one |
| SMILES | CC(C)(C(=O)N1CCOC(CO)C1)S(C)(=O)=O |
| InChI | InChI=1S/C10H19NO5S/c1-10(2,17(3,14)15)9(13)11-4-5-16-8(6-11)7-12/h8,12H,4-7H2,1-3H3 |
| InChIKey | FXGBADZTPROPRS-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |