C8H11BrF3NO2 — CID 81211374
1-[2-(bromomethyl)morpholin-4-yl]-3,3,3-trifluoropropan-1-one (PubChem CID 81211374) has the molecular formula C8H11BrF3NO2 and a molecular weight of 290.08 g/mol. Its IUPAC name is 1-[2-(bromomethyl)morpholin-4-yl]-3,3,3-trifluoropropan-1-one.
| Compound Name | 1-[2-(bromomethyl)morpholin-4-yl]-3,3,3-trifluoropropan-1-one |
|---|---|
| PubChem CID | 81211374 |
| Molecular Formula | C8H11BrF3NO2 |
| Molecular Weight | 290.08 g/mol |
| Exact Mass | 288.99 |
| IUPAC Name | 1-[2-(bromomethyl)morpholin-4-yl]-3,3,3-trifluoropropan-1-one |
| SMILES | O=C(CC(F)(F)F)N1CCOC(CBr)C1 |
| InChI | InChI=1S/C8H11BrF3NO2/c9-4-6-5-13(1-2-15-6)7(14)3-8(10,11)12/h6H,1-5H2 |
| InChIKey | OBXVSJCFRZAXRI-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.08 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|